C14H25N3O2 — CID 82856195
2-(3-amino-4,4-dimethylpentanoyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82856195) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(3-amino-4,4-dimethylpentanoyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-(3-amino-4,4-dimethylpentanoyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82856195 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 2-(3-amino-4,4-dimethylpentanoyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | CC(C)(C)C(N)CC(=O)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2,3)11(15)8-13(19)16-6-7-17-10(9-16)4-5-12(17)18/h10-11H,4-9,15H2,1-3H3 |
| InChIKey | ZSNSURAUSNIYBY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |