C17H23ClN2 — CID 82856484
3'-(2-chlorophenyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,4'-piperidine] (PubChem CID 82856484) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 3'-(2-chlorophenyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,4'-piperidine].
| Compound Name | 3'-(2-chlorophenyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,4'-piperidine] |
|---|---|
| PubChem CID | 82856484 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3'-(2-chlorophenyl)spiro[1,2,3,5,6,8-hexahydropyrrolizine-7,4'-piperidine] |
| SMILES | Clc1ccccc1C1CNCCC12CCN1CCCC12 |
| InChI | InChI=1S/C17H23ClN2/c18-15-5-2-1-4-13(15)14-12-19-9-7-17(14)8-11-20-10-3-6-16(17)20/h1-2,4-5,14,16,19H,3,6-12H2 |
| InChIKey | OXJMRRQCZNFTFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |