C15H15N3O3 — CID 82856523
6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-1H-indole-2,3-dione (PubChem CID 82856523) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-1H-indole-2,3-dione.
| Compound Name | 6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 82856523 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(N3CCN4C(=O)CCC4C3)ccc2C1=O |
| InChI | InChI=1S/C15H15N3O3/c19-13-4-2-10-8-17(5-6-18(10)13)9-1-3-11-12(7-9)16-15(21)14(11)20/h1,3,7,10H,2,4-6,8H2,(H,16,20,21) |
| InChIKey | SOWXSJOSZRVFSS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|