C14H15BrN4OS — CID 82858843
3-(3-bromo-5-methoxyanilino)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 82858843) has the molecular formula C14H15BrN4OS and a molecular weight of 367.27 g/mol. Its IUPAC name is 3-(3-bromo-5-methoxyanilino)-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-(3-bromo-5-methoxyanilino)-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 82858843 |
| Molecular Formula | C14H15BrN4OS |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3-(3-bromo-5-methoxyanilino)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | COc1cc(Br)cc(Nc2nnc(C)c(C)c2C(N)=S)c1 |
| InChI | InChI=1S/C14H15BrN4OS/c1-7-8(2)18-19-14(12(7)13(16)21)17-10-4-9(15)5-11(6-10)20-3/h4-6H,1-3H3,(H2,16,21)(H,17,19) |
| InChIKey | ONBQVFYNKANBRQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|