C11H20N4O3S — CID 82862575
2-piperazin-1-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82862575) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-piperazin-1-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-piperazin-1-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82862575 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-piperazin-1-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(S(=O)(=O)N3CCNCC3)CCN12 |
| InChI | InChI=1S/C11H20N4O3S/c16-11-2-1-10-9-14(7-8-15(10)11)19(17,18)13-5-3-12-4-6-13/h10,12H,1-9H2 |
| InChIKey | IHNGYDMWBCBTTG-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |