C13H22N2O3 — CID 82862867
methyl 2-methyl-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)butanoate (PubChem CID 82862867) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 2-methyl-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)butanoate.
| Compound Name | methyl 2-methyl-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)butanoate |
|---|---|
| PubChem CID | 82862867 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl 2-methyl-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)butanoate |
| SMILES | COC(=O)C(C)C(C)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C13H22N2O3/c1-9(13(17)18-3)10(2)14-6-7-15-11(8-14)4-5-12(15)16/h9-11H,4-8H2,1-3H3 |
| InChIKey | OIVFLPRJETVLNF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |