C14H18ClN3O2 — CID 82863100
N-(3-chloro-4-nitrophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 82863100) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is N-(3-chloro-4-nitrophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-(3-chloro-4-nitrophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 82863100 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-(3-chloro-4-nitrophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2CCN3CCCCC23)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O2/c15-11-9-10(4-5-13(11)18(19)20)16-12-6-8-17-7-2-1-3-14(12)17/h4-5,9,12,14,16H,1-3,6-8H2 |
| InChIKey | MEUHUQLIRYUJOE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|