C14H25BrN2O — CID 82863298
2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82863298) has the molecular formula C14H25BrN2O and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82863298 |
| Molecular Formula | C14H25BrN2O |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | CC(C)(C)C(CBr)CN1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C14H25BrN2O/c1-14(2,3)11(8-15)9-16-6-7-17-12(10-16)4-5-13(17)18/h11-12H,4-10H2,1-3H3 |
| InChIKey | OBBAVTAIKDDMAQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|