C11H19N3O3S — CID 82863813
2-pyrrolidin-3-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82863813) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-pyrrolidin-3-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-pyrrolidin-3-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82863813 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-pyrrolidin-3-ylsulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(S(=O)(=O)C3CCNC3)CCN12 |
| InChI | InChI=1S/C11H19N3O3S/c15-11-2-1-9-8-13(5-6-14(9)11)18(16,17)10-3-4-12-7-10/h9-10,12H,1-8H2 |
| InChIKey | QOXMODUKOXQTIH-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |