C10H14N2O3 — CID 82863978
(E)-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)prop-2-enoic acid (PubChem CID 82863978) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is (E)-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82863978 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (E)-3-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C10H14N2O3/c13-9-2-1-8-7-11(4-3-10(14)15)5-6-12(8)9/h3-4,8H,1-2,5-7H2,(H,14,15)/b4-3+ |
| InChIKey | LWMOQPKWTJSWJW-ONEGZZNKSA-N |
| XLogP | -0.11 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|