C14H24N4O — CID 82864068
N'-cyclohexyl-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide (PubChem CID 82864068) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-cyclohexyl-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide.
| Compound Name | N'-cyclohexyl-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 82864068 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N'-cyclohexyl-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide |
| SMILES | N/C(=N\C1CCCCC1)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C14H24N4O/c15-14(16-11-4-2-1-3-5-11)17-8-9-18-12(10-17)6-7-13(18)19/h11-12H,1-10H2,(H2,15,16) |
| InChIKey | LNBJHZJXECXYGE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|