C12H15N3O5 — CID 82864074
(E)-4-oxo-4-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]but-2-enoic acid (PubChem CID 82864074) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is (E)-4-oxo-4-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 82864074 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (E)-4-oxo-4-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C12H15N3O5/c16-9(2-4-11(18)19)13-12(20)14-5-6-15-8(7-14)1-3-10(15)17/h2,4,8H,1,3,5-7H2,(H,18,19)(H,13,16,20)/b4-2+ |
| InChIKey | DBUHMFYASYZTED-DUXPYHPUSA-N |
| XLogP | -0.83 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|