C12H16BrN3O4 — CID 82864395
2-amino-N-(3-bromo-4-nitrophenyl)-5-methoxypentanamide (PubChem CID 82864395) has the molecular formula C12H16BrN3O4 and a molecular weight of 346.18 g/mol. Its IUPAC name is 2-amino-N-(3-bromo-4-nitrophenyl)-5-methoxypentanamide.
| Compound Name | 2-amino-N-(3-bromo-4-nitrophenyl)-5-methoxypentanamide |
|---|---|
| PubChem CID | 82864395 |
| Molecular Formula | C12H16BrN3O4 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-amino-N-(3-bromo-4-nitrophenyl)-5-methoxypentanamide |
| SMILES | COCCCC(N)C(=O)Nc1ccc([N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3O4/c1-20-6-2-3-10(14)12(17)15-8-4-5-11(16(18)19)9(13)7-8/h4-5,7,10H,2-3,6,14H2,1H3,(H,15,17) |
| InChIKey | BCIFXQMMTKZPQY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|