About 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline
2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline (PubChem CID 82866044) has the molecular formula C12H12BrNS
and a molecular weight of 282.21 g/mol. Its IUPAC name is 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline.
Molecular Properties
| Compound Name | 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline |
| PubChem CID | 82866044 |
| Molecular Formula | C12H12BrNS |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline |
| SMILES | Cc1cc(-c2ccc(N)c(Br)c2)c(C)s1 |
| InChI | InChI=1S/C12H12BrNS/c1-7-5-10(8(2)15-7)9-3-4-12(14)11(13)6-9/h3-6H,14H2,1-2H3 |
| InChIKey | PEQCWNDXKZNXCA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline?
The IUPAC name of 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline (CID 82866044) is 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline.
What is the SMILES notation for 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline?
The canonical SMILES for 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline is Cc1cc(-c2ccc(N)c(Br)c2)c(C)s1.
What is the InChIKey of 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline?
The InChIKey is PEQCWNDXKZNXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNS/c1-7-5-10(8(2)15-7)9-3-4-12(14)11(13)6-9/h3-6H,14H2,1-2H3.
What are the key properties of 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline?
2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline has a molecular weight of 282.21 g/mol, XLogP of 4.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(2,5-dimethylthiophen-3-yl)aniline is sourced from PubChem (CID 82866044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).