C9H16N4S — CID 82866501
3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]propanethioamide (PubChem CID 82866501) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]propanethioamide.
| Compound Name | 3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]propanethioamide |
|---|---|
| PubChem CID | 82866501 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]propanethioamide |
| SMILES | CN(CCC(N)=S)Cc1ccn(C)n1 |
| InChI | InChI=1S/C9H16N4S/c1-12(5-4-9(10)14)7-8-3-6-13(2)11-8/h3,6H,4-5,7H2,1-2H3,(H2,10,14) |
| InChIKey | FOLGZGVPBZMSMJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|