About N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine
N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine (PubChem CID 82866805) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine |
| PubChem CID | 82866805 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine |
| SMILES | Cc1ccc(N(CCCN)Cc2ccn(C)n2)cc1 |
| InChI | InChI=1S/C15H22N4/c1-13-4-6-15(7-5-13)19(10-3-9-16)12-14-8-11-18(2)17-14/h4-8,11H,3,9-10,12,16H2,1-2H3 |
| InChIKey | ZVRLRUXGEVBRFN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine?
The IUPAC name of N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine (CID 82866805) is N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine.
What is the SMILES notation for N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine?
The canonical SMILES for N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine is Cc1ccc(N(CCCN)Cc2ccn(C)n2)cc1.
What is the InChIKey of N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine?
The InChIKey is ZVRLRUXGEVBRFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-13-4-6-15(7-5-13)19(10-3-9-16)12-14-8-11-18(2)17-14/h4-8,11H,3,9-10,12,16H2,1-2H3.
What are the key properties of N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine?
N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine has a molecular weight of 258.37 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-methylphenyl)-N'-[(1-methylpyrazol-3-yl)methyl]propane-1,3-diamine is sourced from PubChem (CID 82866805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).