C16H24BrNO — CID 82868173
3-bromo-5-methoxy-N-(2,4,4-trimethylcyclohexyl)aniline (PubChem CID 82868173) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is 3-bromo-5-methoxy-N-(2,4,4-trimethylcyclohexyl)aniline.
| Compound Name | 3-bromo-5-methoxy-N-(2,4,4-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 82868173 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-bromo-5-methoxy-N-(2,4,4-trimethylcyclohexyl)aniline |
| SMILES | COc1cc(Br)cc(NC2CCC(C)(C)CC2C)c1 |
| InChI | InChI=1S/C16H24BrNO/c1-11-10-16(2,3)6-5-15(11)18-13-7-12(17)8-14(9-13)19-4/h7-9,11,15,18H,5-6,10H2,1-4H3 |
| InChIKey | LDPRYOKBCYXAGO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |