C10H18N4 — CID 82869947
N-methyl-1-[(1-methylpyrazol-3-yl)methyl]pyrrolidin-3-amine (PubChem CID 82869947) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N-methyl-1-[(1-methylpyrazol-3-yl)methyl]pyrrolidin-3-amine.
| Compound Name | N-methyl-1-[(1-methylpyrazol-3-yl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 82869947 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-methyl-1-[(1-methylpyrazol-3-yl)methyl]pyrrolidin-3-amine |
| SMILES | CNC1CCN(Cc2ccn(C)n2)C1 |
| InChI | InChI=1S/C10H18N4/c1-11-9-4-6-14(7-9)8-10-3-5-13(2)12-10/h3,5,9,11H,4,6-8H2,1-2H3 |
| InChIKey | ZQARCQMDLJWULQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |