C15H29N3 — CID 82870837
N-tert-butyl-2-ethyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine (PubChem CID 82870837) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is N-tert-butyl-2-ethyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine.
| Compound Name | N-tert-butyl-2-ethyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 82870837 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N-tert-butyl-2-ethyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine |
| SMILES | CCC(CC)(CNC(C)(C)C)Cc1ccn(C)n1 |
| InChI | InChI=1S/C15H29N3/c1-7-15(8-2,12-16-14(3,4)5)11-13-9-10-18(6)17-13/h9-10,16H,7-8,11-12H2,1-6H3 |
| InChIKey | JLUDRSXVJYVOPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |