C10H19N3 — CID 82871294
N-methyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine (PubChem CID 82871294) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N-methyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine.
| Compound Name | N-methyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 82871294 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-methyl-2-[(1-methylpyrazol-3-yl)methyl]butan-1-amine |
| SMILES | CCC(CNC)Cc1ccn(C)n1 |
| InChI | InChI=1S/C10H19N3/c1-4-9(8-11-2)7-10-5-6-13(3)12-10/h5-6,9,11H,4,7-8H2,1-3H3 |
| InChIKey | PJPLRMMLNOGHQT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |