C14H15N3O3S — CID 82873784
(E)-3-[3-methyl-5-[(1-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 82873784) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is (E)-3-[3-methyl-5-[(1-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methyl-5-[(1-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82873784 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (E)-3-[3-methyl-5-[(1-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1cc(C(=O)NCc2ccn(C)n2)sc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H15N3O3S/c1-9-7-12(21-11(9)3-4-13(18)19)14(20)15-8-10-5-6-17(2)16-10/h3-7H,8H2,1-2H3,(H,15,20)(H,18,19)/b4-3+ |
| InChIKey | YQFLCYHCTCIGLD-ONEGZZNKSA-N |
| XLogP | 1.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|