C14H14N2O5 — CID 82875969
4-[[2-(2-hydroxyphenoxy)acetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 82875969) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-[[2-(2-hydroxyphenoxy)acetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-[[2-(2-hydroxyphenoxy)acetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82875969 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-[[2-(2-hydroxyphenoxy)acetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NC(=O)COc2ccccc2O)c1C(=O)O |
| InChI | InChI=1S/C14H14N2O5/c1-8-13(14(19)20)9(6-15-8)16-12(18)7-21-11-5-3-2-4-10(11)17/h2-6,15,17H,7H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | MSNSJMVDXHICIC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |