C15H12ClFN2O2 — CID 82876177
3-chloro-4-fluoro-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 82876177) has the molecular formula C15H12ClFN2O2 and a molecular weight of 306.72 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | 3-chloro-4-fluoro-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 82876177 |
| Molecular Formula | C15H12ClFN2O2 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-chloro-4-fluoro-N-[3-[(Z)-N-hydroxy-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | C/C(=N/O)c1cccc(NC(=O)c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H12ClFN2O2/c1-9(19-21)10-3-2-4-12(7-10)18-15(20)11-5-6-14(17)13(16)8-11/h2-8,21H,1H3,(H,18,20)/b19-9- |
| InChIKey | DOQJCCXZJHSPKJ-OCKHKDLRSA-N |
| XLogP | 3.93 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|