C15H19ClFN3S — CID 82877116
N-[3-[5-(3-chloro-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine (PubChem CID 82877116) has the molecular formula C15H19ClFN3S and a molecular weight of 327.86 g/mol. Its IUPAC name is N-[3-[5-(3-chloro-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[5-(3-chloro-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 82877116 |
| Molecular Formula | C15H19ClFN3S |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[3-[5-(3-chloro-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCc1nnc(-c2ccc(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H19ClFN3S/c1-10(2)9-18-7-3-4-14-19-20-15(21-14)11-5-6-13(17)12(16)8-11/h5-6,8,10,18H,3-4,7,9H2,1-2H3 |
| InChIKey | OROLINXFBWPURF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|