C15H22N4O2 — CID 82877127
3-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-1-propylpyrazole-4-carbaldehyde (PubChem CID 82877127) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-1-propylpyrazole-4-carbaldehyde.
| Compound Name | 3-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-1-propylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82877127 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-1-propylpyrazole-4-carbaldehyde |
| SMILES | CCCn1cc(C=O)c(-c2c(C)nn(CCOC)c2C)n1 |
| InChI | InChI=1S/C15H22N4O2/c1-5-6-18-9-13(10-20)15(17-18)14-11(2)16-19(12(14)3)7-8-21-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | QASZTGUSKBZJIM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|