C16H14ClFN2O — CID 82877814
3-chloro-4-fluoro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzamide (PubChem CID 82877814) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzamide.
| Compound Name | 3-chloro-4-fluoro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 82877814 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-chloro-4-fluoro-N-(1,2,3,4-tetrahydroquinolin-7-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)NCCC2)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2O/c17-13-8-11(4-6-14(13)18)16(21)20-12-5-3-10-2-1-7-19-15(10)9-12/h3-6,8-9,19H,1-2,7H2,(H,20,21) |
| InChIKey | BZRXCCVQCCKAEO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |