C12H20N2OS2 — CID 82877907
1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylpyrazol-3-yl)ethanol (PubChem CID 82877907) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylpyrazol-3-yl)ethanol.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 82877907 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylpyrazol-3-yl)ethanol |
| SMILES | CCC1SCCSC1C(O)Cc1ccn(C)n1 |
| InChI | InChI=1S/C12H20N2OS2/c1-3-11-12(17-7-6-16-11)10(15)8-9-4-5-14(2)13-9/h4-5,10-12,15H,3,6-8H2,1-2H3 |
| InChIKey | DLRSMUAQRVWPSF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |