C12H19N5 — CID 82878256
N-ethyl-1,2-bis(1-methylpyrazol-3-yl)ethanamine (PubChem CID 82878256) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is N-ethyl-1,2-bis(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-ethyl-1,2-bis(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82878256 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-ethyl-1,2-bis(1-methylpyrazol-3-yl)ethanamine |
| SMILES | CCNC(Cc1ccn(C)n1)c1ccn(C)n1 |
| InChI | InChI=1S/C12H19N5/c1-4-13-12(11-6-8-17(3)15-11)9-10-5-7-16(2)14-10/h5-8,12-13H,4,9H2,1-3H3 |
| InChIKey | HELLVWKXDWDAAG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |