About [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol
[5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol (PubChem CID 82878332) has the molecular formula C10H9ClFN3O
and a molecular weight of 241.65 g/mol. Its IUPAC name is [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol |
| PubChem CID | 82878332 |
| Molecular Formula | C10H9ClFN3O |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol |
| SMILES | Cn1c(CO)nnc1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClFN3O/c1-15-9(5-16)13-14-10(15)6-2-3-8(12)7(11)4-6/h2-4,16H,5H2,1H3 |
| InChIKey | OBTUCXCCTWJAPT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol?
The IUPAC name of [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol (CID 82878332) is [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol.
What is the SMILES notation for [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol?
The canonical SMILES for [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol is Cn1c(CO)nnc1-c1ccc(F)c(Cl)c1.
What is the InChIKey of [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol?
The InChIKey is OBTUCXCCTWJAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClFN3O/c1-15-9(5-16)13-14-10(15)6-2-3-8(12)7(11)4-6/h2-4,16H,5H2,1H3.
What are the key properties of [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol?
[5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol has a molecular weight of 241.65 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-chloro-4-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]methanol is sourced from PubChem (CID 82878332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).