C13H13Cl2NO3S2 — CID 82878613
5-chloro-N-[(5-chlorothiophen-2-yl)methyl]-3-(hydroxymethyl)-2-methylbenzenesulfonamide (PubChem CID 82878613) has the molecular formula C13H13Cl2NO3S2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 5-chloro-N-[(5-chlorothiophen-2-yl)methyl]-3-(hydroxymethyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[(5-chlorothiophen-2-yl)methyl]-3-(hydroxymethyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 82878613 |
| Molecular Formula | C13H13Cl2NO3S2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 5-chloro-N-[(5-chlorothiophen-2-yl)methyl]-3-(hydroxymethyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(CO)cc(Cl)cc1S(=O)(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H13Cl2NO3S2/c1-8-9(7-17)4-10(14)5-12(8)21(18,19)16-6-11-2-3-13(15)20-11/h2-5,16-17H,6-7H2,1H3 |
| InChIKey | HXWFHCXFXVCJLK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |