About [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine
[5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine (PubChem CID 82879638) has the molecular formula C14H21ClN2O2S2
and a molecular weight of 348.92 g/mol. Its IUPAC name is [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine.
Molecular Properties
| Compound Name | [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine |
| PubChem CID | 82879638 |
| Molecular Formula | C14H21ClN2O2S2 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine |
| SMILES | Cc1c(CN)cc(Cl)cc1S(=O)(=O)N1CC(C)SC(C)C1 |
| InChI | InChI=1S/C14H21ClN2O2S2/c1-9-7-17(8-10(2)20-9)21(18,19)14-5-13(15)4-12(6-16)11(14)3/h4-5,9-10H,6-8,16H2,1-3H3 |
| InChIKey | CACWMIAWXXPVEG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine?
The IUPAC name of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine (CID 82879638) is [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine.
What is the SMILES notation for [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine?
The canonical SMILES for [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine is Cc1c(CN)cc(Cl)cc1S(=O)(=O)N1CC(C)SC(C)C1.
What is the InChIKey of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine?
The InChIKey is CACWMIAWXXPVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClN2O2S2/c1-9-7-17(8-10(2)20-9)21(18,19)14-5-13(15)4-12(6-16)11(14)3/h4-5,9-10H,6-8,16H2,1-3H3.
What are the key properties of [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine?
[5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine has a molecular weight of 348.92 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-3-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-2-methylphenyl]methanamine is sourced from PubChem (CID 82879638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).