About N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine
N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine (PubChem CID 82880308) has the molecular formula C11H16N4S
and a molecular weight of 236.34 g/mol. Its IUPAC name is N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine |
| PubChem CID | 82880308 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine |
| SMILES | CCNCCCc1cnn(-c2nccs2)c1 |
| InChI | InChI=1S/C11H16N4S/c1-2-12-5-3-4-10-8-14-15(9-10)11-13-6-7-16-11/h6-9,12H,2-5H2,1H3 |
| InChIKey | HZTXBKFLMYBJSG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine?
The IUPAC name of N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine (CID 82880308) is N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine.
What is the SMILES notation for N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine?
The canonical SMILES for N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine is CCNCCCc1cnn(-c2nccs2)c1.
What is the InChIKey of N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine?
The InChIKey is HZTXBKFLMYBJSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4S/c1-2-12-5-3-4-10-8-14-15(9-10)11-13-6-7-16-11/h6-9,12H,2-5H2,1H3.
What are the key properties of N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine?
N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine has a molecular weight of 236.34 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]propan-1-amine is sourced from PubChem (CID 82880308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).