About 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine
6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 82880801) has the molecular formula C9H8N6S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 82880801 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N)c2cnn(-c3nccs3)c2n1 |
| InChI | InChI=1S/C9H8N6S/c1-5-13-7(10)6-4-12-15(8(6)14-5)9-11-2-3-16-9/h2-4H,1H3,(H2,10,13,14) |
| InChIKey | ZUCSQMAVGYDNPD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine (CID 82880801) is 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine is Cc1nc(N)c2cnn(-c3nccs3)c2n1.
What is the InChIKey of 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is ZUCSQMAVGYDNPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6S/c1-5-13-7(10)6-4-12-15(8(6)14-5)9-11-2-3-16-9/h2-4H,1H3,(H2,10,13,14).
What are the key properties of 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine?
6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 232.27 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 82880801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).