C14H10Cl3NO3 — CID 82880967
4-chloro-N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxybenzamide (PubChem CID 82880967) has the molecular formula C14H10Cl3NO3 and a molecular weight of 346.60 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxybenzamide.
| Compound Name | 4-chloro-N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 82880967 |
| Molecular Formula | C14H10Cl3NO3 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 4-chloro-N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxybenzamide |
| SMILES | COc1cc(Cl)ccc1C(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3NO3/c1-21-12-4-7(15)2-3-9(12)14(20)18-8-5-10(16)13(19)11(17)6-8/h2-6,19H,1H3,(H,18,20) |
| InChIKey | ORUKOZUOTDFWMF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|