C10H17N3OS — CID 82881570
N-[(1-methylpyrazol-3-yl)methyl]-1-oxothian-4-amine (PubChem CID 82881570) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-[(1-methylpyrazol-3-yl)methyl]-1-oxothian-4-amine.
| Compound Name | N-[(1-methylpyrazol-3-yl)methyl]-1-oxothian-4-amine |
|---|---|
| PubChem CID | 82881570 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[(1-methylpyrazol-3-yl)methyl]-1-oxothian-4-amine |
| SMILES | Cn1ccc(CNC2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C10H17N3OS/c1-13-5-2-10(12-13)8-11-9-3-6-15(14)7-4-9/h2,5,9,11H,3-4,6-8H2,1H3 |
| InChIKey | UMFCUZFFGRUPFM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |