C10H16N2O2 — CID 82882518
2,3-dimethyl-4-(1-methylpyrazol-3-yl)butanoic acid (PubChem CID 82882518) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,3-dimethyl-4-(1-methylpyrazol-3-yl)butanoic acid.
| Compound Name | 2,3-dimethyl-4-(1-methylpyrazol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 82882518 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2,3-dimethyl-4-(1-methylpyrazol-3-yl)butanoic acid |
| SMILES | CC(Cc1ccn(C)n1)C(C)C(=O)O |
| InChI | InChI=1S/C10H16N2O2/c1-7(8(2)10(13)14)6-9-4-5-12(3)11-9/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
| InChIKey | JDTDBHDFSGVUFN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |