ethyl 3,5-dichloro-2-methylbenzoate

C10H10Cl2O2 — CID 82883321

IUPACethyl 3,5-dichloro-2-methylbenzoate
SMILESCCOC(=O)c1cc(Cl)cc(Cl)c1C
InChIInChI=1S/C10H10Cl2O2/c1-3-14-10(13)8-4-7(11)5-9(12)6(8)2/h4-5H,3H2,1-2H3
InChIKeyLNDGTBJYHKCCSO-UHFFFAOYSA-N
MW233.09 g/mol
LogP3.48
Rot. Bonds2

About ethyl 3,5-dichloro-2-methylbenzoate

ethyl 3,5-dichloro-2-methylbenzoate (PubChem CID 82883321) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is ethyl 3,5-dichloro-2-methylbenzoate.

Molecular Properties

Compound Nameethyl 3,5-dichloro-2-methylbenzoate
PubChem CID82883321
Molecular FormulaC10H10Cl2O2
Molecular Weight233.09 g/mol
Exact Mass232.01
IUPAC Nameethyl 3,5-dichloro-2-methylbenzoate
SMILESCCOC(=O)c1cc(Cl)cc(Cl)c1C
InChIInChI=1S/C10H10Cl2O2/c1-3-14-10(13)8-4-7(11)5-9(12)6(8)2/h4-5H,3H2,1-2H3
InChIKeyLNDGTBJYHKCCSO-UHFFFAOYSA-N
XLogP3.48
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.09
LogP ≤ 53.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze ethyl 3,5-dichloro-2-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethyl 2-amino-3,5-dichlorobenzoate
CID 15087809
ethyl 3,5-dichloro-2-iodobenzoate
CID 75361260
ethyl 3-chloro-5-iodo-2-methylbenzoate
CID 107097679
ethyl 2,4,6-trichlorobenzoate
CID 91733956
diethyl 4,5-dichlorobenzene-1,2-dicarboxylate
CID 10517655
diethyl 4-chlorobenzene-1,2-dicarboxylate
CID 14910056
ethyl 2-chloro-4,5-dimethylbenzoate
CID 82550536
ethyl 2-chloro-4,5-dihydroxybenzoate
CID 54196354
propyl 2,3,5-trichlorobenzoate
CID 22448170
ethyl 2-bromo-4,6-dichlorobenzoate
CID 165358373
ethyl 2,5-dibromo-3-chlorobenzoate
CID 114374037
ethyl 3-bromo-5-chloro-2-ethoxybenzoate
CID 50880228

Frequently Asked Questions

What is the IUPAC name of ethyl 3,5-dichloro-2-methylbenzoate?
The IUPAC name of ethyl 3,5-dichloro-2-methylbenzoate (CID 82883321) is ethyl 3,5-dichloro-2-methylbenzoate.
What is the SMILES notation for ethyl 3,5-dichloro-2-methylbenzoate?
The canonical SMILES for ethyl 3,5-dichloro-2-methylbenzoate is CCOC(=O)c1cc(Cl)cc(Cl)c1C.
What is the InChIKey of ethyl 3,5-dichloro-2-methylbenzoate?
The InChIKey is LNDGTBJYHKCCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O2/c1-3-14-10(13)8-4-7(11)5-9(12)6(8)2/h4-5H,3H2,1-2H3.
What are the key properties of ethyl 3,5-dichloro-2-methylbenzoate?
ethyl 3,5-dichloro-2-methylbenzoate has a molecular weight of 233.09 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dichloro-2-methylbenzoate is sourced from PubChem (CID 82883321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).