C17H20ClN — CID 82884123
N-[(5-chloro-2-methylphenyl)-(4-methylphenyl)methyl]ethanamine (PubChem CID 82884123) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is N-[(5-chloro-2-methylphenyl)-(4-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(5-chloro-2-methylphenyl)-(4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 82884123 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[(5-chloro-2-methylphenyl)-(4-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(C)cc1)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C17H20ClN/c1-4-19-17(14-8-5-12(2)6-9-14)16-11-15(18)10-7-13(16)3/h5-11,17,19H,4H2,1-3H3 |
| InChIKey | MSBMMECLOFSZFW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |