About 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide
5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 82884636) has the molecular formula C13H19ClN2O2S
and a molecular weight of 302.83 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide |
| PubChem CID | 82884636 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(Cl)cc(S(=O)(=O)N(C)C2CC2)c1C |
| InChI | InChI=1S/C13H19ClN2O2S/c1-9-10(8-15-2)6-11(14)7-13(9)19(17,18)16(3)12-4-5-12/h6-7,12,15H,4-5,8H2,1-3H3 |
| InChIKey | KQLMEMRBIFWCAB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide?
The IUPAC name of 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide (CID 82884636) is 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide.
What is the SMILES notation for 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide?
The canonical SMILES for 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide is CNCc1cc(Cl)cc(S(=O)(=O)N(C)C2CC2)c1C.
What is the InChIKey of 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide?
The InChIKey is KQLMEMRBIFWCAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2O2S/c1-9-10(8-15-2)6-11(14)7-13(9)19(17,18)16(3)12-4-5-12/h6-7,12,15H,4-5,8H2,1-3H3.
What are the key properties of 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide?
5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide has a molecular weight of 302.83 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-cyclopropyl-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide is sourced from PubChem (CID 82884636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).