C14H10F2O3S — CID 82885335
methyl 2-[5-(3,4-difluorobenzoyl)thiophen-2-yl]acetate (PubChem CID 82885335) has the molecular formula C14H10F2O3S and a molecular weight of 296.29 g/mol. Its IUPAC name is methyl 2-[5-(3,4-difluorobenzoyl)thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-(3,4-difluorobenzoyl)thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 82885335 |
| Molecular Formula | C14H10F2O3S |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | methyl 2-[5-(3,4-difluorobenzoyl)thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(C(=O)c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C14H10F2O3S/c1-19-13(17)7-9-3-5-12(20-9)14(18)8-2-4-10(15)11(16)6-8/h2-6H,7H2,1H3 |
| InChIKey | BSROWMOLUZTWBZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |