About 2-isocyanato-1,3-dihydroindene-2-carbonitrile
2-isocyanato-1,3-dihydroindene-2-carbonitrile (PubChem CID 82885486) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-isocyanato-1,3-dihydroindene-2-carbonitrile.
Molecular Properties
| Compound Name | 2-isocyanato-1,3-dihydroindene-2-carbonitrile |
| PubChem CID | 82885486 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-isocyanato-1,3-dihydroindene-2-carbonitrile |
| SMILES | N#CC1(N=C=O)Cc2ccccc2C1 |
| InChI | InChI=1S/C11H8N2O/c12-7-11(13-8-14)5-9-3-1-2-4-10(9)6-11/h1-4H,5-6H2 |
| InChIKey | BXTSHMYWNXZLSI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-1,3-dihydroindene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-1,3-dihydroindene-2-carbonitrile?
The IUPAC name of 2-isocyanato-1,3-dihydroindene-2-carbonitrile (CID 82885486) is 2-isocyanato-1,3-dihydroindene-2-carbonitrile.
What is the SMILES notation for 2-isocyanato-1,3-dihydroindene-2-carbonitrile?
The canonical SMILES for 2-isocyanato-1,3-dihydroindene-2-carbonitrile is N#CC1(N=C=O)Cc2ccccc2C1.
What is the InChIKey of 2-isocyanato-1,3-dihydroindene-2-carbonitrile?
The InChIKey is BXTSHMYWNXZLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c12-7-11(13-8-14)5-9-3-1-2-4-10(9)6-11/h1-4H,5-6H2.
What are the key properties of 2-isocyanato-1,3-dihydroindene-2-carbonitrile?
2-isocyanato-1,3-dihydroindene-2-carbonitrile has a molecular weight of 184.20 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-1,3-dihydroindene-2-carbonitrile is sourced from PubChem (CID 82885486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).