C12H16O2S — CID 82886000
(5R)-9-ethoxy-1,3,4,5-tetrahydro-2-benzothiepin-5-ol (PubChem CID 82886000) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is (5R)-9-ethoxy-1,3,4,5-tetrahydro-2-benzothiepin-5-ol.
| Compound Name | (5R)-9-ethoxy-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
|---|---|
| PubChem CID | 82886000 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (5R)-9-ethoxy-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
| SMILES | CCOc1cccc2c1CSCC[C@H]2O |
| InChI | InChI=1S/C12H16O2S/c1-2-14-12-5-3-4-9-10(12)8-15-7-6-11(9)13/h3-5,11,13H,2,6-8H2,1H3/t11-/m1/s1 |
| InChIKey | PUWCZNVRMXXGHW-LLVKDONJSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |