C16H26BrN3O — CID 82886078
N-[[2-bromo-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]methyl]ethanamine (PubChem CID 82886078) has the molecular formula C16H26BrN3O and a molecular weight of 356.31 g/mol. Its IUPAC name is N-[[2-bromo-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[2-bromo-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 82886078 |
| Molecular Formula | C16H26BrN3O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[[2-bromo-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(OCCN2CCN(C)CC2)ccc1Br |
| InChI | InChI=1S/C16H26BrN3O/c1-3-18-13-14-12-15(4-5-16(14)17)21-11-10-20-8-6-19(2)7-9-20/h4-5,12,18H,3,6-11,13H2,1-2H3 |
| InChIKey | POCFHAVTLQYVIY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |