C16H26N2O2S — CID 82886267
2-[5-[[3-(2-methylpiperidin-1-yl)propylamino]methyl]thiophen-2-yl]acetic acid (PubChem CID 82886267) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-[5-[[3-(2-methylpiperidin-1-yl)propylamino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[3-(2-methylpiperidin-1-yl)propylamino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82886267 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[5-[[3-(2-methylpiperidin-1-yl)propylamino]methyl]thiophen-2-yl]acetic acid |
| SMILES | CC1CCCCN1CCCNCc1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C16H26N2O2S/c1-13-5-2-3-9-18(13)10-4-8-17-12-15-7-6-14(21-15)11-16(19)20/h6-7,13,17H,2-5,8-12H2,1H3,(H,19,20) |
| InChIKey | QJAMMDXWCSRJNP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|