C15H13FN2O2S — CID 82886294
methyl 2-[5-[(4-cyano-2-fluoroanilino)methyl]thiophen-2-yl]acetate (PubChem CID 82886294) has the molecular formula C15H13FN2O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 2-[5-[(4-cyano-2-fluoroanilino)methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[(4-cyano-2-fluoroanilino)methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 82886294 |
| Molecular Formula | C15H13FN2O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl 2-[5-[(4-cyano-2-fluoroanilino)methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNc2ccc(C#N)cc2F)s1 |
| InChI | InChI=1S/C15H13FN2O2S/c1-20-15(19)7-11-3-4-12(21-11)9-18-14-5-2-10(8-17)6-13(14)16/h2-6,18H,7,9H2,1H3 |
| InChIKey | JZTKKHJIHHQSGC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |