About 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine
7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 82886352) has the molecular formula C10H11F2NS
and a molecular weight of 215.27 g/mol. Its IUPAC name is 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine.
Molecular Properties
| Compound Name | 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine |
| PubChem CID | 82886352 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CC1SCc2c(ccc(F)c2F)C1N |
| InChI | InChI=1S/C10H11F2NS/c1-5-10(13)6-2-3-8(11)9(12)7(6)4-14-5/h2-3,5,10H,4,13H2,1H3 |
| InChIKey | NSVMFUOBFAXOPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine?
The IUPAC name of 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine (CID 82886352) is 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine.
What is the SMILES notation for 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine?
The canonical SMILES for 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine is CC1SCc2c(ccc(F)c2F)C1N.
What is the InChIKey of 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine?
The InChIKey is NSVMFUOBFAXOPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NS/c1-5-10(13)6-2-3-8(11)9(12)7(6)4-14-5/h2-3,5,10H,4,13H2,1H3.
What are the key properties of 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine?
7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine has a molecular weight of 215.27 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-3-methyl-3,4-dihydro-1H-isothiochromen-4-amine is sourced from PubChem (CID 82886352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).