About 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one
5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one (PubChem CID 82886764) has the molecular formula C13H16O3S
and a molecular weight of 252.33 g/mol. Its IUPAC name is 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one.
Molecular Properties
| Compound Name | 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one |
| PubChem CID | 82886764 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one |
| SMILES | COc1ccc(OC)c2c1CSC(C)(C)C2=O |
| InChI | InChI=1S/C13H16O3S/c1-13(2)12(14)11-8(7-17-13)9(15-3)5-6-10(11)16-4/h5-6H,7H2,1-4H3 |
| InChIKey | QIIIOYHCEREZDH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one?
The IUPAC name of 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one (CID 82886764) is 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one.
What is the SMILES notation for 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one?
The canonical SMILES for 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one is COc1ccc(OC)c2c1CSC(C)(C)C2=O.
What is the InChIKey of 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one?
The InChIKey is QIIIOYHCEREZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3S/c1-13(2)12(14)11-8(7-17-13)9(15-3)5-6-10(11)16-4/h5-6H,7H2,1-4H3.
What are the key properties of 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one?
5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one has a molecular weight of 252.33 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethoxy-3,3-dimethyl-1H-isothiochromen-4-one is sourced from PubChem (CID 82886764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).