About 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one
8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one (PubChem CID 82886966) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one.
Molecular Properties
| Compound Name | 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one |
| PubChem CID | 82886966 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one |
| SMILES | COc1ccc(C)c2c1CSC(C)(C)C2=O |
| InChI | InChI=1S/C13H16O2S/c1-8-5-6-10(15-4)9-7-16-13(2,3)12(14)11(8)9/h5-6H,7H2,1-4H3 |
| InChIKey | XJURDYBNYYZBOK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one?
The IUPAC name of 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one (CID 82886966) is 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one.
What is the SMILES notation for 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one?
The canonical SMILES for 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one is COc1ccc(C)c2c1CSC(C)(C)C2=O.
What is the InChIKey of 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one?
The InChIKey is XJURDYBNYYZBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c1-8-5-6-10(15-4)9-7-16-13(2,3)12(14)11(8)9/h5-6H,7H2,1-4H3.
What are the key properties of 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one?
8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one has a molecular weight of 236.34 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-3,3,5-trimethyl-1H-isothiochromen-4-one is sourced from PubChem (CID 82886966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).