About 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine
8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine (PubChem CID 82887047) has the molecular formula C15H23NOS
and a molecular weight of 265.42 g/mol. Its IUPAC name is 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine.
Molecular Properties
| Compound Name | 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine |
| PubChem CID | 82887047 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine |
| SMILES | CCCNC1c2cccc(OC)c2CSC1(C)C |
| InChI | InChI=1S/C15H23NOS/c1-5-9-16-14-11-7-6-8-13(17-4)12(11)10-18-15(14,2)3/h6-8,14,16H,5,9-10H2,1-4H3 |
| InChIKey | OSQIPNFLHSKGIQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine?
The IUPAC name of 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine (CID 82887047) is 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine.
What is the SMILES notation for 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine?
The canonical SMILES for 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine is CCCNC1c2cccc(OC)c2CSC1(C)C.
What is the InChIKey of 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine?
The InChIKey is OSQIPNFLHSKGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOS/c1-5-9-16-14-11-7-6-8-13(17-4)12(11)10-18-15(14,2)3/h6-8,14,16H,5,9-10H2,1-4H3.
What are the key properties of 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine?
8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine has a molecular weight of 265.42 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-3,3-dimethyl-N-propyl-1,4-dihydroisothiochromen-4-amine is sourced from PubChem (CID 82887047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).