About 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one
3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one (PubChem CID 82887302) has the molecular formula C14H18OS
and a molecular weight of 234.36 g/mol. Its IUPAC name is 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one.
Molecular Properties
| Compound Name | 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one |
| PubChem CID | 82887302 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one |
| SMILES | CC1CC(=O)c2cc(C(C)C)ccc2CS1 |
| InChI | InChI=1S/C14H18OS/c1-9(2)11-4-5-12-8-16-10(3)6-14(15)13(12)7-11/h4-5,7,9-10H,6,8H2,1-3H3 |
| InChIKey | JTWPYTVJPDCRNI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one?
The IUPAC name of 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one (CID 82887302) is 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one.
What is the SMILES notation for 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one?
The canonical SMILES for 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one is CC1CC(=O)c2cc(C(C)C)ccc2CS1.
What is the InChIKey of 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one?
The InChIKey is JTWPYTVJPDCRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18OS/c1-9(2)11-4-5-12-8-16-10(3)6-14(15)13(12)7-11/h4-5,7,9-10H,6,8H2,1-3H3.
What are the key properties of 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one?
3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one has a molecular weight of 234.36 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-propan-2-yl-3,4-dihydro-1H-2-benzothiepin-5-one is sourced from PubChem (CID 82887302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).